About 3-(5-chloro-7-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanamide
3-(5-chloro-7-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanamide (PubChem CID 19611694) has the molecular formula C11H11ClFNO2
and a molecular weight of 243.66 g/mol. Its IUPAC name is 3-(5-chloro-7-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanamide.
Molecular Properties
| Compound Name | 3-(5-chloro-7-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanamide |
| PubChem CID | 19611694 |
| Molecular Formula | C11H11ClFNO2 |
| Molecular Weight | 243.66 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 3-(5-chloro-7-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanamide |
| SMILES | NC(=O)CCc1c(Cl)cc(F)c2c1CCO2 |
| InChI | InChI=1S/C11H11ClFNO2/c12-8-5-9(13)11-7(3-4-16-11)6(8)1-2-10(14)15/h5H,1-4H2,(H2,14,15) |
| InChIKey | VYADOMNNKOGLJB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.66 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(5-chloro-7-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-chloro-7-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanamide?
The IUPAC name of 3-(5-chloro-7-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanamide (CID 19611694) is 3-(5-chloro-7-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanamide.
What is the SMILES notation for 3-(5-chloro-7-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanamide?
The canonical SMILES for 3-(5-chloro-7-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanamide is NC(=O)CCc1c(Cl)cc(F)c2c1CCO2.
What is the InChIKey of 3-(5-chloro-7-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanamide?
The InChIKey is VYADOMNNKOGLJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClFNO2/c12-8-5-9(13)11-7(3-4-16-11)6(8)1-2-10(14)15/h5H,1-4H2,(H2,14,15).
What are the key properties of 3-(5-chloro-7-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanamide?
3-(5-chloro-7-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanamide has a molecular weight of 243.66 g/mol, XLogP of 1.83, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-7-fluoro-2,3-dihydro-1-benzofuran-4-yl)propanamide is sourced from PubChem (CID 19611694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).