C27H26F3NO — CID 19612162
1-[2-(2-methoxy-5-phenylphenyl)ethyl]-4-(2,4,5-trifluoro-3-methylphenyl)-3,6-dihydro-2H-pyridine (PubChem CID 19612162) has the molecular formula C27H26F3NO and a molecular weight of 437.51 g/mol. Its IUPAC name is 1-[2-(2-methoxy-5-phenylphenyl)ethyl]-4-(2,4,5-trifluoro-3-methylphenyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[2-(2-methoxy-5-phenylphenyl)ethyl]-4-(2,4,5-trifluoro-3-methylphenyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 19612162 |
| Molecular Formula | C27H26F3NO |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 1-[2-(2-methoxy-5-phenylphenyl)ethyl]-4-(2,4,5-trifluoro-3-methylphenyl)-3,6-dihydro-2H-pyridine |
| SMILES | COc1ccc(-c2ccccc2)cc1CCN1CC=C(c2cc(F)c(F)c(C)c2F)CC1 |
| InChI | InChI=1S/C27H26F3NO/c1-18-26(29)23(17-24(28)27(18)30)20-10-13-31(14-11-20)15-12-22-16-21(8-9-25(22)32-2)19-6-4-3-5-7-19/h3-10,16-17H,11-15H2,1-2H3 |
| InChIKey | WGBOFVNGJKEONS-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|