About (4-amino-2-cyanophenyl) thiocyanate
(4-amino-2-cyanophenyl) thiocyanate (PubChem CID 19612245) has the molecular formula C8H5N3S
and a molecular weight of 175.22 g/mol. Its IUPAC name is (4-amino-2-cyanophenyl) thiocyanate.
Molecular Properties
| Compound Name | (4-amino-2-cyanophenyl) thiocyanate |
| PubChem CID | 19612245 |
| Molecular Formula | C8H5N3S |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | (4-amino-2-cyanophenyl) thiocyanate |
| SMILES | N#CSc1ccc(N)cc1C#N |
| InChI | InChI=1S/C8H5N3S/c9-4-6-3-7(11)1-2-8(6)12-5-10/h1-3H,11H2 |
| InChIKey | WSOZPFQIDOZLQJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 73.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-2-cyanophenyl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-2-cyanophenyl) thiocyanate?
The IUPAC name of (4-amino-2-cyanophenyl) thiocyanate (CID 19612245) is (4-amino-2-cyanophenyl) thiocyanate.
What is the SMILES notation for (4-amino-2-cyanophenyl) thiocyanate?
The canonical SMILES for (4-amino-2-cyanophenyl) thiocyanate is N#CSc1ccc(N)cc1C#N.
What is the InChIKey of (4-amino-2-cyanophenyl) thiocyanate?
The InChIKey is WSOZPFQIDOZLQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3S/c9-4-6-3-7(11)1-2-8(6)12-5-10/h1-3H,11H2.
What are the key properties of (4-amino-2-cyanophenyl) thiocyanate?
(4-amino-2-cyanophenyl) thiocyanate has a molecular weight of 175.22 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-2-cyanophenyl) thiocyanate is sourced from PubChem (CID 19612245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).