C12H11ClF6O3 — CID 19612257
[4-chloro-3-methoxy-2,5-bis(2,2,2-trifluoroethyl)phenyl]methanediol (PubChem CID 19612257) has the molecular formula C12H11ClF6O3 and a molecular weight of 352.66 g/mol. Its IUPAC name is [4-chloro-3-methoxy-2,5-bis(2,2,2-trifluoroethyl)phenyl]methanediol.
| Compound Name | [4-chloro-3-methoxy-2,5-bis(2,2,2-trifluoroethyl)phenyl]methanediol |
|---|---|
| PubChem CID | 19612257 |
| Molecular Formula | C12H11ClF6O3 |
| Molecular Weight | 352.66 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | [4-chloro-3-methoxy-2,5-bis(2,2,2-trifluoroethyl)phenyl]methanediol |
| SMILES | COc1c(Cl)c(CC(F)(F)F)cc(C(O)O)c1CC(F)(F)F |
| InChI | InChI=1S/C12H11ClF6O3/c1-22-9-7(4-12(17,18)19)6(10(20)21)2-5(8(9)13)3-11(14,15)16/h2,10,20-21H,3-4H2,1H3 |
| InChIKey | PJMUDNZOMCHYGG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.66 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|