C9H14N4 — CID 19612494
5-(1,5-dimethyl-1,2,4-triazol-3-yl)-1,2,3,6-tetrahydropyridine (PubChem CID 19612494) has the molecular formula C9H14N4 and a molecular weight of 178.24 g/mol. Its IUPAC name is 5-(1,5-dimethyl-1,2,4-triazol-3-yl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 5-(1,5-dimethyl-1,2,4-triazol-3-yl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 19612494 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 5-(1,5-dimethyl-1,2,4-triazol-3-yl)-1,2,3,6-tetrahydropyridine |
| SMILES | Cc1nc(C2=CCCNC2)nn1C |
| InChI | InChI=1S/C9H14N4/c1-7-11-9(12-13(7)2)8-4-3-5-10-6-8/h4,10H,3,5-6H2,1-2H3 |
| InChIKey | VSIDVMCKERFTLA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |