C10H13N5 — CID 19612498
3-methyl-5-(2-prop-2-ynyltetrazol-5-yl)-1,2,3,6-tetrahydropyridine (PubChem CID 19612498) has the molecular formula C10H13N5 and a molecular weight of 203.25 g/mol. Its IUPAC name is 3-methyl-5-(2-prop-2-ynyltetrazol-5-yl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 3-methyl-5-(2-prop-2-ynyltetrazol-5-yl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 19612498 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 3-methyl-5-(2-prop-2-ynyltetrazol-5-yl)-1,2,3,6-tetrahydropyridine |
| SMILES | C#CCn1nnc(C2=CC(C)CNC2)n1 |
| InChI | InChI=1S/C10H13N5/c1-3-4-15-13-10(12-14-15)9-5-8(2)6-11-7-9/h1,5,8,11H,4,6-7H2,2H3 |
| InChIKey | XQVQMQSVVGUJSF-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|