About 1,2-dimethyl-5-(2-propan-2-yltetrazol-5-yl)-3,6-dihydro-2H-pyridine
1,2-dimethyl-5-(2-propan-2-yltetrazol-5-yl)-3,6-dihydro-2H-pyridine (PubChem CID 19612505) has the molecular formula C11H19N5
and a molecular weight of 221.31 g/mol. Its IUPAC name is 1,2-dimethyl-5-(2-propan-2-yltetrazol-5-yl)-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1,2-dimethyl-5-(2-propan-2-yltetrazol-5-yl)-3,6-dihydro-2H-pyridine |
| PubChem CID | 19612505 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 1,2-dimethyl-5-(2-propan-2-yltetrazol-5-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CC1CC=C(c2nnn(C(C)C)n2)CN1C |
| InChI | InChI=1S/C11H19N5/c1-8(2)16-13-11(12-14-16)10-6-5-9(3)15(4)7-10/h6,8-9H,5,7H2,1-4H3 |
| InChIKey | BJHCLFQHIIFIBQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,2-dimethyl-5-(2-propan-2-yltetrazol-5-yl)-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-5-(2-propan-2-yltetrazol-5-yl)-3,6-dihydro-2H-pyridine?
The IUPAC name of 1,2-dimethyl-5-(2-propan-2-yltetrazol-5-yl)-3,6-dihydro-2H-pyridine (CID 19612505) is 1,2-dimethyl-5-(2-propan-2-yltetrazol-5-yl)-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1,2-dimethyl-5-(2-propan-2-yltetrazol-5-yl)-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1,2-dimethyl-5-(2-propan-2-yltetrazol-5-yl)-3,6-dihydro-2H-pyridine is CC1CC=C(c2nnn(C(C)C)n2)CN1C.
What is the InChIKey of 1,2-dimethyl-5-(2-propan-2-yltetrazol-5-yl)-3,6-dihydro-2H-pyridine?
The InChIKey is BJHCLFQHIIFIBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N5/c1-8(2)16-13-11(12-14-16)10-6-5-9(3)15(4)7-10/h6,8-9H,5,7H2,1-4H3.
What are the key properties of 1,2-dimethyl-5-(2-propan-2-yltetrazol-5-yl)-3,6-dihydro-2H-pyridine?
1,2-dimethyl-5-(2-propan-2-yltetrazol-5-yl)-3,6-dihydro-2H-pyridine has a molecular weight of 221.31 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-5-(2-propan-2-yltetrazol-5-yl)-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 19612505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).