About 1,2-dimethyl-5-(2-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine
1,2-dimethyl-5-(2-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine (PubChem CID 19612512) has the molecular formula C9H15N5
and a molecular weight of 193.25 g/mol. Its IUPAC name is 1,2-dimethyl-5-(2-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1,2-dimethyl-5-(2-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine |
| PubChem CID | 19612512 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 1,2-dimethyl-5-(2-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CC1CC=C(c2nnn(C)n2)CN1C |
| InChI | InChI=1S/C9H15N5/c1-7-4-5-8(6-13(7)2)9-10-12-14(3)11-9/h5,7H,4,6H2,1-3H3 |
| InChIKey | GQYGLHNXCXFQNO-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,2-dimethyl-5-(2-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-5-(2-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine?
The IUPAC name of 1,2-dimethyl-5-(2-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine (CID 19612512) is 1,2-dimethyl-5-(2-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1,2-dimethyl-5-(2-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1,2-dimethyl-5-(2-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine is CC1CC=C(c2nnn(C)n2)CN1C.
What is the InChIKey of 1,2-dimethyl-5-(2-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine?
The InChIKey is GQYGLHNXCXFQNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5/c1-7-4-5-8(6-13(7)2)9-10-12-14(3)11-9/h5,7H,4,6H2,1-3H3.
What are the key properties of 1,2-dimethyl-5-(2-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine?
1,2-dimethyl-5-(2-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine has a molecular weight of 193.25 g/mol, XLogP of 0.32, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-5-(2-methyltetrazol-5-yl)-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 19612512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).