C9H11N5 — CID 19612519
6-(2-prop-2-ynyltetrazol-5-yl)-1,2,3,6-tetrahydropyridine (PubChem CID 19612519) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is 6-(2-prop-2-ynyltetrazol-5-yl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 6-(2-prop-2-ynyltetrazol-5-yl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 19612519 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 6-(2-prop-2-ynyltetrazol-5-yl)-1,2,3,6-tetrahydropyridine |
| SMILES | C#CCn1nnc(C2C=CCCN2)n1 |
| InChI | InChI=1S/C9H11N5/c1-2-7-14-12-9(11-13-14)8-5-3-4-6-10-8/h1,3,5,8,10H,4,6-7H2 |
| InChIKey | JFWXWQLFMLVNRH-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|