C17H24N4O4S4 — CID 19612564
3-[4-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)butylsulfanyl]-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid (PubChem CID 19612564) has the molecular formula C17H24N4O4S4 and a molecular weight of 476.67 g/mol. Its IUPAC name is 3-[4-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)butylsulfanyl]-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid.
| Compound Name | 3-[4-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)butylsulfanyl]-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid |
|---|---|
| PubChem CID | 19612564 |
| Molecular Formula | C17H24N4O4S4 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 3-[4-(4,5-dihydro-1,3-thiazol-2-ylsulfanyl)butylsulfanyl]-4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazole;oxalic acid |
| SMILES | CN1CCC=C(c2nsnc2SCCCCSC2=NCCS2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H22N4S4.C2H2O4/c1-19-7-4-5-12(11-19)13-14(18-23-17-13)20-8-2-3-9-21-15-16-6-10-22-15;3-1(4)2(5)6/h5H,2-4,6-11H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | AKWLOUCTLRAWJM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|