C4H2N8O10 — CID 19612675
3,3a,4,6-tetranitro-1,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione (PubChem CID 19612675) has the molecular formula C4H2N8O10 and a molecular weight of 322.11 g/mol. Its IUPAC name is 3,3a,4,6-tetranitro-1,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione.
| Compound Name | 3,3a,4,6-tetranitro-1,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 19612675 |
| Molecular Formula | C4H2N8O10 |
| Molecular Weight | 322.11 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 3,3a,4,6-tetranitro-1,6a-dihydroimidazo[4,5-d]imidazole-2,5-dione |
| SMILES | O=C1NC2N([N+](=O)[O-])C(=O)N([N+](=O)[O-])C2([N+](=O)[O-])N1[N+](=O)[O-] |
| InChI | InChI=1S/C4H2N8O10/c13-2-5-1-4(9(15)16,7(2)11(19)20)8(12(21)22)3(14)6(1)10(17)18/h1H,(H,5,13) |
| InChIKey | GRNLCFHROQVCNL-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 228.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.11 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|