C17H18F3N5OS — CID 19614072
1-butyl-7-(1,3-dimethylpyrazol-4-yl)-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one (PubChem CID 19614072) has the molecular formula C17H18F3N5OS and a molecular weight of 397.43 g/mol. Its IUPAC name is 1-butyl-7-(1,3-dimethylpyrazol-4-yl)-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 1-butyl-7-(1,3-dimethylpyrazol-4-yl)-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 19614072 |
| Molecular Formula | C17H18F3N5OS |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 1-butyl-7-(1,3-dimethylpyrazol-4-yl)-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
| SMILES | CCCCn1c(=S)[nH]c(=O)c2c(C(F)(F)F)cc(-c3cn(C)nc3C)nc21 |
| InChI | InChI=1S/C17H18F3N5OS/c1-4-5-6-25-14-13(15(26)22-16(25)27)11(17(18,19)20)7-12(21-14)10-8-24(3)23-9(10)2/h7-8H,4-6H2,1-3H3,(H,22,26,27) |
| InChIKey | VPONJHDWUXCRSV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 68.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|