C15H16ClN5O5S — CID 19614391
N-[2-(4-chloro-3-nitropyrazol-1-yl)ethyl]-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide (PubChem CID 19614391) has the molecular formula C15H16ClN5O5S and a molecular weight of 413.84 g/mol. Its IUPAC name is N-[2-(4-chloro-3-nitropyrazol-1-yl)ethyl]-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide.
| Compound Name | N-[2-(4-chloro-3-nitropyrazol-1-yl)ethyl]-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 19614391 |
| Molecular Formula | C15H16ClN5O5S |
| Molecular Weight | 413.84 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | N-[2-(4-chloro-3-nitropyrazol-1-yl)ethyl]-4-(2-oxopyrrolidin-1-yl)benzenesulfonamide |
| SMILES | O=C1CCCN1c1ccc(S(=O)(=O)NCCn2cc(Cl)c([N+](=O)[O-])n2)cc1 |
| InChI | InChI=1S/C15H16ClN5O5S/c16-13-10-19(18-15(13)21(23)24)9-7-17-27(25,26)12-5-3-11(4-6-12)20-8-1-2-14(20)22/h3-6,10,17H,1-2,7-9H2 |
| InChIKey | YIYMJZIUESYQMA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 127.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.84 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|