C29H37NO4 — CID 19614605
(E)-1-[1-(3-ethoxy-4-hydroxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one (PubChem CID 19614605) has the molecular formula C29H37NO4 and a molecular weight of 463.62 g/mol. Its IUPAC name is (E)-1-[1-(3-ethoxy-4-hydroxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[1-(3-ethoxy-4-hydroxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19614605 |
| Molecular Formula | C29H37NO4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | (E)-1-[1-(3-ethoxy-4-hydroxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one |
| SMILES | CCOc1cc(C2C3CCCCC3(O)CCN2C(=O)/C=C/c2ccc(C(C)C)cc2)ccc1O |
| InChI | InChI=1S/C29H37NO4/c1-4-34-26-19-23(13-14-25(26)31)28-24-7-5-6-16-29(24,33)17-18-30(28)27(32)15-10-21-8-11-22(12-9-21)20(2)3/h8-15,19-20,24,28,31,33H,4-7,16-18H2,1-3H3/b15-10+ |
| InChIKey | GDDAKERLPJTVKL-XNTDXEJSSA-N |
| XLogP | 5.82 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|