C12H13ClN2 — CID 19615
8-chloro-2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 19615) has the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. Its IUPAC name is 8-chloro-2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 8-chloro-2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 19615 |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 8-chloro-2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | CN1CCc2[nH]c3ccc(Cl)cc3c2C1 |
| InChI | InChI=1S/C12H13ClN2/c1-15-5-4-12-10(7-15)9-6-8(13)2-3-11(9)14-12/h2-3,6,14H,4-5,7H2,1H3 |
| InChIKey | KFCWIHUDWIRLEE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|