C9H6ClF3N6S — CID 19616087
6-(4-chloro-1,5-dimethylpyrazol-3-yl)-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 19616087) has the molecular formula C9H6ClF3N6S and a molecular weight of 322.70 g/mol. Its IUPAC name is 6-(4-chloro-1,5-dimethylpyrazol-3-yl)-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(4-chloro-1,5-dimethylpyrazol-3-yl)-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 19616087 |
| Molecular Formula | C9H6ClF3N6S |
| Molecular Weight | 322.70 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 6-(4-chloro-1,5-dimethylpyrazol-3-yl)-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1c(Cl)c(-c2nn3c(C(F)(F)F)nnc3s2)nn1C |
| InChI | InChI=1S/C9H6ClF3N6S/c1-3-4(10)5(16-18(3)2)6-17-19-7(9(11,12)13)14-15-8(19)20-6/h1-2H3 |
| InChIKey | YRPHOJGCILONGL-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.70 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |