C8H10F2N2 — CID 19616647
3-(difluoromethyl)-4,5,6,7-tetrahydro-1H-indazole (PubChem CID 19616647) has the molecular formula C8H10F2N2 and a molecular weight of 172.18 g/mol. Its IUPAC name is 3-(difluoromethyl)-4,5,6,7-tetrahydro-1H-indazole.
| Compound Name | 3-(difluoromethyl)-4,5,6,7-tetrahydro-1H-indazole |
|---|---|
| PubChem CID | 19616647 |
| Molecular Formula | C8H10F2N2 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 3-(difluoromethyl)-4,5,6,7-tetrahydro-1H-indazole |
| SMILES | FC(F)c1n[nH]c2c1CCCC2 |
| InChI | InChI=1S/C8H10F2N2/c9-8(10)7-5-3-1-2-4-6(5)11-12-7/h8H,1-4H2,(H,11,12) |
| InChIKey | OGUSNGSCFPPYNE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |