C9H15BrN2O2 — CID 19616899
4-bromo-1-(2,2-diethoxyethyl)pyrazole (PubChem CID 19616899) has the molecular formula C9H15BrN2O2 and a molecular weight of 263.13 g/mol. Its IUPAC name is 4-bromo-1-(2,2-diethoxyethyl)pyrazole.
| Compound Name | 4-bromo-1-(2,2-diethoxyethyl)pyrazole |
|---|---|
| PubChem CID | 19616899 |
| Molecular Formula | C9H15BrN2O2 |
| Molecular Weight | 263.13 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 4-bromo-1-(2,2-diethoxyethyl)pyrazole |
| SMILES | CCOC(Cn1cc(Br)cn1)OCC |
| InChI | InChI=1S/C9H15BrN2O2/c1-3-13-9(14-4-2)7-12-6-8(10)5-11-12/h5-6,9H,3-4,7H2,1-2H3 |
| InChIKey | SJEKPJLQKVGRCC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.13 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|