C11H16N8O3S — CID 19616934
2-[[4-ethyl-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetohydrazide (PubChem CID 19616934) has the molecular formula C11H16N8O3S and a molecular weight of 340.37 g/mol. Its IUPAC name is 2-[[4-ethyl-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetohydrazide.
| Compound Name | 2-[[4-ethyl-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 19616934 |
| Molecular Formula | C11H16N8O3S |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 2-[[4-ethyl-5-[2-(4-nitropyrazol-1-yl)ethyl]-1,2,4-triazol-3-yl]sulfanyl]acetohydrazide |
| SMILES | CCn1c(CCn2cc([N+](=O)[O-])cn2)nnc1SCC(=O)NN |
| InChI | InChI=1S/C11H16N8O3S/c1-2-18-9(15-16-11(18)23-7-10(20)14-12)3-4-17-6-8(5-13-17)19(21)22/h5-6H,2-4,7,12H2,1H3,(H,14,20) |
| InChIKey | TVSGHOYDZGCANS-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|