About ethyl 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetate
ethyl 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetate (PubChem CID 19618243) has the molecular formula C9H10F4N2O2
and a molecular weight of 254.18 g/mol. Its IUPAC name is ethyl 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetate |
| PubChem CID | 19618243 |
| Molecular Formula | C9H10F4N2O2 |
| Molecular Weight | 254.18 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | ethyl 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetate |
| SMILES | CCOC(=O)Cn1nc(C(F)F)cc1C(F)F |
| InChI | InChI=1S/C9H10F4N2O2/c1-2-17-7(16)4-15-6(9(12)13)3-5(14-15)8(10)11/h3,8-9H,2,4H2,1H3 |
| InChIKey | OFRIPBLMPRXVMH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetate?
The IUPAC name of ethyl 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetate (CID 19618243) is ethyl 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetate.
What is the SMILES notation for ethyl 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetate?
The canonical SMILES for ethyl 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetate is CCOC(=O)Cn1nc(C(F)F)cc1C(F)F.
What is the InChIKey of ethyl 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetate?
The InChIKey is OFRIPBLMPRXVMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F4N2O2/c1-2-17-7(16)4-15-6(9(12)13)3-5(14-15)8(10)11/h3,8-9H,2,4H2,1H3.
What are the key properties of ethyl 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetate?
ethyl 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetate has a molecular weight of 254.18 g/mol, XLogP of 2.32, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3,5-bis(difluoromethyl)pyrazol-1-yl]acetate is sourced from PubChem (CID 19618243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).