C11H10F2N4O2 — CID 19618706
1-[(2,4-difluorophenoxy)methyl]pyrazole-3-carbohydrazide (PubChem CID 19618706) has the molecular formula C11H10F2N4O2 and a molecular weight of 268.22 g/mol. Its IUPAC name is 1-[(2,4-difluorophenoxy)methyl]pyrazole-3-carbohydrazide.
| Compound Name | 1-[(2,4-difluorophenoxy)methyl]pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 19618706 |
| Molecular Formula | C11H10F2N4O2 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1-[(2,4-difluorophenoxy)methyl]pyrazole-3-carbohydrazide |
| SMILES | NNC(=O)c1ccn(COc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C11H10F2N4O2/c12-7-1-2-10(8(13)5-7)19-6-17-4-3-9(16-17)11(18)15-14/h1-5H,6,14H2,(H,15,18) |
| InChIKey | CHYPNLRYWQCZQH-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|