C13H12ClN3O5 — CID 19618862
1-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-nitropyrazole-3-carboxylic acid (PubChem CID 19618862) has the molecular formula C13H12ClN3O5 and a molecular weight of 325.71 g/mol. Its IUPAC name is 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-nitropyrazole-3-carboxylic acid.
| Compound Name | 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-nitropyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19618862 |
| Molecular Formula | C13H12ClN3O5 |
| Molecular Weight | 325.71 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 1-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-nitropyrazole-3-carboxylic acid |
| SMILES | Cc1cc(OCn2cc([N+](=O)[O-])c(C(=O)O)n2)cc(C)c1Cl |
| InChI | InChI=1S/C13H12ClN3O5/c1-7-3-9(4-8(2)11(7)14)22-6-16-5-10(17(20)21)12(15-16)13(18)19/h3-5H,6H2,1-2H3,(H,18,19) |
| InChIKey | IZBOZBQMNZBZOJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.71 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|