C13H17N3O2 — CID 19619255
3,4-dimethoxy-N-[(2-methylpyrazol-3-yl)methyl]aniline (PubChem CID 19619255) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[(2-methylpyrazol-3-yl)methyl]aniline.
| Compound Name | 3,4-dimethoxy-N-[(2-methylpyrazol-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 19619255 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 3,4-dimethoxy-N-[(2-methylpyrazol-3-yl)methyl]aniline |
| SMILES | COc1ccc(NCc2ccnn2C)cc1OC |
| InChI | InChI=1S/C13H17N3O2/c1-16-11(6-7-15-16)9-14-10-4-5-12(17-2)13(8-10)18-3/h4-8,14H,9H2,1-3H3 |
| InChIKey | FHWIFTOMQYMMEE-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|