C10H14ClN7OS — CID 19619600
2-[[5-(4-chloro-1-methylpyrazol-3-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetohydrazide (PubChem CID 19619600) has the molecular formula C10H14ClN7OS and a molecular weight of 315.79 g/mol. Its IUPAC name is 2-[[5-(4-chloro-1-methylpyrazol-3-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetohydrazide.
| Compound Name | 2-[[5-(4-chloro-1-methylpyrazol-3-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 19619600 |
| Molecular Formula | C10H14ClN7OS |
| Molecular Weight | 315.79 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-[[5-(4-chloro-1-methylpyrazol-3-yl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]acetohydrazide |
| SMILES | CCn1c(SCC(=O)NN)nnc1-c1nn(C)cc1Cl |
| InChI | InChI=1S/C10H14ClN7OS/c1-3-18-9(8-6(11)4-17(2)16-8)14-15-10(18)20-5-7(19)13-12/h4H,3,5,12H2,1-2H3,(H,13,19) |
| InChIKey | OBHYXGLCRRPPHF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.79 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|