About 2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanol
2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanol (PubChem CID 19619764) has the molecular formula C7H11BrN2O
and a molecular weight of 219.08 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanol |
| PubChem CID | 19619764 |
| Molecular Formula | C7H11BrN2O |
| Molecular Weight | 219.08 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanol |
| SMILES | Cc1nn(CCO)c(C)c1Br |
| InChI | InChI=1S/C7H11BrN2O/c1-5-7(8)6(2)10(9-5)3-4-11/h11H,3-4H2,1-2H3 |
| InChIKey | CUUAPMBWZYSQSB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.08 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanol?
The IUPAC name of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanol (CID 19619764) is 2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanol.
What is the SMILES notation for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanol?
The canonical SMILES for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanol is Cc1nn(CCO)c(C)c1Br.
What is the InChIKey of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanol?
The InChIKey is CUUAPMBWZYSQSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11BrN2O/c1-5-7(8)6(2)10(9-5)3-4-11/h11H,3-4H2,1-2H3.
What are the key properties of 2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanol?
2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanol has a molecular weight of 219.08 g/mol, XLogP of 1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-3,5-dimethylpyrazol-1-yl)ethanol is sourced from PubChem (CID 19619764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).