C9H14ClN3O2 — CID 19619969
ethyl 3-amino-4-chloro-1-propan-2-ylpyrazole-5-carboxylate (PubChem CID 19619969) has the molecular formula C9H14ClN3O2 and a molecular weight of 231.68 g/mol. Its IUPAC name is ethyl 3-amino-4-chloro-1-propan-2-ylpyrazole-5-carboxylate.
| Compound Name | ethyl 3-amino-4-chloro-1-propan-2-ylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 19619969 |
| Molecular Formula | C9H14ClN3O2 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | ethyl 3-amino-4-chloro-1-propan-2-ylpyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1c(Cl)c(N)nn1C(C)C |
| InChI | InChI=1S/C9H14ClN3O2/c1-4-15-9(14)7-6(10)8(11)12-13(7)5(2)3/h5H,4H2,1-3H3,(H2,11,12) |
| InChIKey | LHANORIUQOGQTO-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |