C9H10ClN5O2 — CID 19620183
4-chloro-3,5-dimethyl-1-[(4-nitropyrazol-1-yl)methyl]pyrazole (PubChem CID 19620183) has the molecular formula C9H10ClN5O2 and a molecular weight of 255.66 g/mol. Its IUPAC name is 4-chloro-3,5-dimethyl-1-[(4-nitropyrazol-1-yl)methyl]pyrazole.
| Compound Name | 4-chloro-3,5-dimethyl-1-[(4-nitropyrazol-1-yl)methyl]pyrazole |
|---|---|
| PubChem CID | 19620183 |
| Molecular Formula | C9H10ClN5O2 |
| Molecular Weight | 255.66 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 4-chloro-3,5-dimethyl-1-[(4-nitropyrazol-1-yl)methyl]pyrazole |
| SMILES | Cc1nn(Cn2cc([N+](=O)[O-])cn2)c(C)c1Cl |
| InChI | InChI=1S/C9H10ClN5O2/c1-6-9(10)7(2)14(12-6)5-13-4-8(3-11-13)15(16)17/h3-4H,5H2,1-2H3 |
| InChIKey | OACNKZCBWSXHAF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 78.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.66 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|