C11H15ClN6O — CID 19620445
4-amino-N-[2-(4-chloropyrazol-1-yl)ethyl]-1-ethylpyrazole-5-carboxamide (PubChem CID 19620445) has the molecular formula C11H15ClN6O and a molecular weight of 282.73 g/mol. Its IUPAC name is 4-amino-N-[2-(4-chloropyrazol-1-yl)ethyl]-1-ethylpyrazole-5-carboxamide.
| Compound Name | 4-amino-N-[2-(4-chloropyrazol-1-yl)ethyl]-1-ethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19620445 |
| Molecular Formula | C11H15ClN6O |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 4-amino-N-[2-(4-chloropyrazol-1-yl)ethyl]-1-ethylpyrazole-5-carboxamide |
| SMILES | CCn1ncc(N)c1C(=O)NCCn1cc(Cl)cn1 |
| InChI | InChI=1S/C11H15ClN6O/c1-2-18-10(9(13)6-16-18)11(19)14-3-4-17-7-8(12)5-15-17/h5-7H,2-4,13H2,1H3,(H,14,19) |
| InChIKey | XFXOTIPGEPPGAP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |