About 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid
3-(3-amino-1,2,4-triazol-1-yl)propanoic acid (PubChem CID 19620639) has the molecular formula C5H8N4O2
and a molecular weight of 156.15 g/mol. Its IUPAC name is 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid |
| PubChem CID | 19620639 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid |
| SMILES | Nc1ncn(CCC(=O)O)n1 |
| InChI | InChI=1S/C5H8N4O2/c6-5-7-3-9(8-5)2-1-4(10)11/h3H,1-2H2,(H2,6,8)(H,10,11) |
| InChIKey | IRWIBRVWUGWMCK-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid?
The IUPAC name of 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid (CID 19620639) is 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid.
What is the SMILES notation for 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid?
The canonical SMILES for 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid is Nc1ncn(CCC(=O)O)n1.
What is the InChIKey of 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid?
The InChIKey is IRWIBRVWUGWMCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4O2/c6-5-7-3-9(8-5)2-1-4(10)11/h3H,1-2H2,(H2,6,8)(H,10,11).
What are the key properties of 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid?
3-(3-amino-1,2,4-triazol-1-yl)propanoic acid has a molecular weight of 156.15 g/mol, XLogP of -0.67, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-amino-1,2,4-triazol-1-yl)propanoic acid is sourced from PubChem (CID 19620639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).