C10H10ClF3N2O — CID 19620718
3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanoyl chloride (PubChem CID 19620718) has the molecular formula C10H10ClF3N2O and a molecular weight of 266.65 g/mol. Its IUPAC name is 3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanoyl chloride.
| Compound Name | 3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanoyl chloride |
|---|---|
| PubChem CID | 19620718 |
| Molecular Formula | C10H10ClF3N2O |
| Molecular Weight | 266.65 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanoyl chloride |
| SMILES | O=C(Cl)CCn1nc(C(F)(F)F)cc1C1CC1 |
| InChI | InChI=1S/C10H10ClF3N2O/c11-9(17)3-4-16-7(6-1-2-6)5-8(15-16)10(12,13)14/h5-6H,1-4H2 |
| InChIKey | HRBUCGGOKQYPCJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.65 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|