About 1-propylpyrazol-4-amine
1-propylpyrazol-4-amine (PubChem CID 19620834) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is 1-propylpyrazol-4-amine.
Molecular Properties
| Compound Name | 1-propylpyrazol-4-amine |
| PubChem CID | 19620834 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 1-propylpyrazol-4-amine |
| SMILES | CCCn1cc(N)cn1 |
| InChI | InChI=1S/C6H11N3/c1-2-3-9-5-6(7)4-8-9/h4-5H,2-3,7H2,1H3 |
| InChIKey | DMDDBNVQWLCYMJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-propylpyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propylpyrazol-4-amine?
The IUPAC name of 1-propylpyrazol-4-amine (CID 19620834) is 1-propylpyrazol-4-amine.
What is the SMILES notation for 1-propylpyrazol-4-amine?
The canonical SMILES for 1-propylpyrazol-4-amine is CCCn1cc(N)cn1.
What is the InChIKey of 1-propylpyrazol-4-amine?
The InChIKey is DMDDBNVQWLCYMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3/c1-2-3-9-5-6(7)4-8-9/h4-5H,2-3,7H2,1H3.
What are the key properties of 1-propylpyrazol-4-amine?
1-propylpyrazol-4-amine has a molecular weight of 125.17 g/mol, XLogP of 0.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propylpyrazol-4-amine is sourced from PubChem (CID 19620834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).