About N'-[4-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine
N'-[4-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine (PubChem CID 19621199) has the molecular formula C11H13F3N6
and a molecular weight of 286.26 g/mol. Its IUPAC name is N'-[4-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[4-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine |
| PubChem CID | 19621199 |
| Molecular Formula | C11H13F3N6 |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | N'-[4-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine |
| SMILES | Cn1ccc(-c2cc(C(F)(F)F)nc(NCCN)n2)n1 |
| InChI | InChI=1S/C11H13F3N6/c1-20-5-2-7(19-20)8-6-9(11(12,13)14)18-10(17-8)16-4-3-15/h2,5-6H,3-4,15H2,1H3,(H,16,17,18) |
| InChIKey | UMYIFMJTNVBJBY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N'-[4-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine?
The IUPAC name of N'-[4-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine (CID 19621199) is N'-[4-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine.
What is the SMILES notation for N'-[4-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine?
The canonical SMILES for N'-[4-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine is Cn1ccc(-c2cc(C(F)(F)F)nc(NCCN)n2)n1.
What is the InChIKey of N'-[4-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine?
The InChIKey is UMYIFMJTNVBJBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F3N6/c1-20-5-2-7(19-20)8-6-9(11(12,13)14)18-10(17-8)16-4-3-15/h2,5-6H,3-4,15H2,1H3,(H,16,17,18).
What are the key properties of N'-[4-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine?
N'-[4-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine has a molecular weight of 286.26 g/mol, XLogP of 1.27, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-(1-methylpyrazol-3-yl)-6-(trifluoromethyl)pyrimidin-2-yl]ethane-1,2-diamine is sourced from PubChem (CID 19621199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).