C8H9ClN4 — CID 19621326
4-chloro-5-(1-ethylpyrazol-4-yl)-1H-pyrazole (PubChem CID 19621326) has the molecular formula C8H9ClN4 and a molecular weight of 196.64 g/mol. Its IUPAC name is 4-chloro-5-(1-ethylpyrazol-4-yl)-1H-pyrazole.
| Compound Name | 4-chloro-5-(1-ethylpyrazol-4-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 19621326 |
| Molecular Formula | C8H9ClN4 |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 4-chloro-5-(1-ethylpyrazol-4-yl)-1H-pyrazole |
| SMILES | CCn1cc(-c2[nH]ncc2Cl)cn1 |
| InChI | InChI=1S/C8H9ClN4/c1-2-13-5-6(3-11-13)8-7(9)4-10-12-8/h3-5H,2H2,1H3,(H,10,12) |
| InChIKey | YINLYIIAQZOMEF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |