About methyl 4-amino-1,5-dimethylpyrazole-3-carboxylate
methyl 4-amino-1,5-dimethylpyrazole-3-carboxylate (PubChem CID 19622696) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is methyl 4-amino-1,5-dimethylpyrazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4-amino-1,5-dimethylpyrazole-3-carboxylate |
| PubChem CID | 19622696 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | methyl 4-amino-1,5-dimethylpyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(C)c(C)c1N |
| InChI | InChI=1S/C7H11N3O2/c1-4-5(8)6(7(11)12-3)9-10(4)2/h8H2,1-3H3 |
| InChIKey | PPPYRJSMLGWDHP-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-amino-1,5-dimethylpyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-1,5-dimethylpyrazole-3-carboxylate?
The IUPAC name of methyl 4-amino-1,5-dimethylpyrazole-3-carboxylate (CID 19622696) is methyl 4-amino-1,5-dimethylpyrazole-3-carboxylate.
What is the SMILES notation for methyl 4-amino-1,5-dimethylpyrazole-3-carboxylate?
The canonical SMILES for methyl 4-amino-1,5-dimethylpyrazole-3-carboxylate is COC(=O)c1nn(C)c(C)c1N.
What is the InChIKey of methyl 4-amino-1,5-dimethylpyrazole-3-carboxylate?
The InChIKey is PPPYRJSMLGWDHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c1-4-5(8)6(7(11)12-3)9-10(4)2/h8H2,1-3H3.
What are the key properties of methyl 4-amino-1,5-dimethylpyrazole-3-carboxylate?
methyl 4-amino-1,5-dimethylpyrazole-3-carboxylate has a molecular weight of 169.18 g/mol, XLogP of 0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-1,5-dimethylpyrazole-3-carboxylate is sourced from PubChem (CID 19622696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).