C10H10F4N2O2 — CID 19622820
3-cyclopropyl-1-(2,2,3,3-tetrafluoropropyl)pyrazole-4-carboxylic acid (PubChem CID 19622820) has the molecular formula C10H10F4N2O2 and a molecular weight of 266.19 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2,2,3,3-tetrafluoropropyl)pyrazole-4-carboxylic acid.
| Compound Name | 3-cyclopropyl-1-(2,2,3,3-tetrafluoropropyl)pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 19622820 |
| Molecular Formula | C10H10F4N2O2 |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 3-cyclopropyl-1-(2,2,3,3-tetrafluoropropyl)pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(CC(F)(F)C(F)F)nc1C1CC1 |
| InChI | InChI=1S/C10H10F4N2O2/c11-9(12)10(13,14)4-16-3-6(8(17)18)7(15-16)5-1-2-5/h3,5,9H,1-2,4H2,(H,17,18) |
| InChIKey | SDAFYVCGMIJLLC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|