1-(2,2-difluoroethyl)-3-methylpyrazole-4-carboxylic acid

C7H8F2N2O2 — CID 19622823

IUPAC1-(2,2-difluoroethyl)-3-methylpyrazole-4-carboxylic acid
SMILESCc1nn(CC(F)F)cc1C(=O)O
InChIInChI=1S/C7H8F2N2O2/c1-4-5(7(12)13)2-11(10-4)3-6(8)9/h2,6H,3H2,1H3,(H,12,13)
InChIKeyQKFOCVIKVFMEFR-UHFFFAOYSA-N
MW190.15 g/mol
LogP1.15
Rot. Bonds3

About 1-(2,2-difluoroethyl)-3-methylpyrazole-4-carboxylic acid

1-(2,2-difluoroethyl)-3-methylpyrazole-4-carboxylic acid (PubChem CID 19622823) has the molecular formula C7H8F2N2O2 and a molecular weight of 190.15 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-methylpyrazole-4-carboxylic acid.

Molecular Properties

Compound Name1-(2,2-difluoroethyl)-3-methylpyrazole-4-carboxylic acid
PubChem CID19622823
Molecular FormulaC7H8F2N2O2
Molecular Weight190.15 g/mol
Exact Mass190.06
IUPAC Name1-(2,2-difluoroethyl)-3-methylpyrazole-4-carboxylic acid
SMILESCc1nn(CC(F)F)cc1C(=O)O
InChIInChI=1S/C7H8F2N2O2/c1-4-5(7(12)13)2-11(10-4)3-6(8)9/h2,6H,3H2,1H3,(H,12,13)
InChIKeyQKFOCVIKVFMEFR-UHFFFAOYSA-N
XLogP1.15
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.15
LogP ≤ 51.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-(2,2-difluoroethyl)-3-methylpyrazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,2-difluoroethyl)-3-methylpyrazole-4-carboxylic acid?
The IUPAC name of 1-(2,2-difluoroethyl)-3-methylpyrazole-4-carboxylic acid (CID 19622823) is 1-(2,2-difluoroethyl)-3-methylpyrazole-4-carboxylic acid.
What is the SMILES notation for 1-(2,2-difluoroethyl)-3-methylpyrazole-4-carboxylic acid?
The canonical SMILES for 1-(2,2-difluoroethyl)-3-methylpyrazole-4-carboxylic acid is Cc1nn(CC(F)F)cc1C(=O)O.
What is the InChIKey of 1-(2,2-difluoroethyl)-3-methylpyrazole-4-carboxylic acid?
The InChIKey is QKFOCVIKVFMEFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2N2O2/c1-4-5(7(12)13)2-11(10-4)3-6(8)9/h2,6H,3H2,1H3,(H,12,13).
What are the key properties of 1-(2,2-difluoroethyl)-3-methylpyrazole-4-carboxylic acid?
1-(2,2-difluoroethyl)-3-methylpyrazole-4-carboxylic acid has a molecular weight of 190.15 g/mol, XLogP of 1.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)-3-methylpyrazole-4-carboxylic acid is sourced from PubChem (CID 19622823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).