C5H7F2N3 — CID 19622830
1-(2,2-difluoroethyl)pyrazol-3-amine (PubChem CID 19622830) has the molecular formula C5H7F2N3 and a molecular weight of 147.13 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)pyrazol-3-amine.
| Compound Name | 1-(2,2-difluoroethyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 19622830 |
| Molecular Formula | C5H7F2N3 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.06 |
| IUPAC Name | 1-(2,2-difluoroethyl)pyrazol-3-amine |
| SMILES | Nc1ccn(CC(F)F)n1 |
| InChI | InChI=1S/C5H7F2N3/c6-4(7)3-10-2-1-5(8)9-10/h1-2,4H,3H2,(H2,8,9) |
| InChIKey | IEUJFYRUNRRGQY-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |