C6H6BrF4N3 — CID 19622833
4-bromo-1-(2,2,3,3-tetrafluoropropyl)pyrazol-3-amine (PubChem CID 19622833) has the molecular formula C6H6BrF4N3 and a molecular weight of 276.03 g/mol. Its IUPAC name is 4-bromo-1-(2,2,3,3-tetrafluoropropyl)pyrazol-3-amine.
| Compound Name | 4-bromo-1-(2,2,3,3-tetrafluoropropyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 19622833 |
| Molecular Formula | C6H6BrF4N3 |
| Molecular Weight | 276.03 g/mol |
| Exact Mass | 274.97 |
| IUPAC Name | 4-bromo-1-(2,2,3,3-tetrafluoropropyl)pyrazol-3-amine |
| SMILES | Nc1nn(CC(F)(F)C(F)F)cc1Br |
| InChI | InChI=1S/C6H6BrF4N3/c7-3-1-14(13-4(3)12)2-6(10,11)5(8)9/h1,5H,2H2,(H2,12,13) |
| InChIKey | PJVRQIUNVKVJOA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.03 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|