About 4-bromo-1-(2,2-difluoroethyl)pyrazol-3-amine
4-bromo-1-(2,2-difluoroethyl)pyrazol-3-amine (PubChem CID 19622834) has the molecular formula C5H6BrF2N3
and a molecular weight of 226.02 g/mol. Its IUPAC name is 4-bromo-1-(2,2-difluoroethyl)pyrazol-3-amine.
Molecular Properties
| Compound Name | 4-bromo-1-(2,2-difluoroethyl)pyrazol-3-amine |
| PubChem CID | 19622834 |
| Molecular Formula | C5H6BrF2N3 |
| Molecular Weight | 226.02 g/mol |
| Exact Mass | 224.97 |
| IUPAC Name | 4-bromo-1-(2,2-difluoroethyl)pyrazol-3-amine |
| SMILES | Nc1nn(CC(F)F)cc1Br |
| InChI | InChI=1S/C5H6BrF2N3/c6-3-1-11(2-4(7)8)10-5(3)9/h1,4H,2H2,(H2,9,10) |
| InChIKey | IAGSVTWZLHIZRX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.02 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-1-(2,2-difluoroethyl)pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1-(2,2-difluoroethyl)pyrazol-3-amine?
The IUPAC name of 4-bromo-1-(2,2-difluoroethyl)pyrazol-3-amine (CID 19622834) is 4-bromo-1-(2,2-difluoroethyl)pyrazol-3-amine.
What is the SMILES notation for 4-bromo-1-(2,2-difluoroethyl)pyrazol-3-amine?
The canonical SMILES for 4-bromo-1-(2,2-difluoroethyl)pyrazol-3-amine is Nc1nn(CC(F)F)cc1Br.
What is the InChIKey of 4-bromo-1-(2,2-difluoroethyl)pyrazol-3-amine?
The InChIKey is IAGSVTWZLHIZRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6BrF2N3/c6-3-1-11(2-4(7)8)10-5(3)9/h1,4H,2H2,(H2,9,10).
What are the key properties of 4-bromo-1-(2,2-difluoroethyl)pyrazol-3-amine?
4-bromo-1-(2,2-difluoroethyl)pyrazol-3-amine has a molecular weight of 226.02 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1-(2,2-difluoroethyl)pyrazol-3-amine is sourced from PubChem (CID 19622834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).