C10H11F3N2O2 — CID 19622871
(E)-3-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoic acid (PubChem CID 19622871) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is (E)-3-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 19622871 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | (E)-3-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]prop-2-enoic acid |
| SMILES | Cc1nn(CC(F)(F)F)c(C)c1/C=C/C(=O)O |
| InChI | InChI=1S/C10H11F3N2O2/c1-6-8(3-4-9(16)17)7(2)15(14-6)5-10(11,12)13/h3-4H,5H2,1-2H3,(H,16,17)/b4-3+ |
| InChIKey | XZCYTROFDVXCJV-ONEGZZNKSA-N |
| XLogP | 2.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|