About 3,5-dichloro-2-(2,2-difluoroethoxy)aniline
3,5-dichloro-2-(2,2-difluoroethoxy)aniline (PubChem CID 19622891) has the molecular formula C8H7Cl2F2NO
and a molecular weight of 242.05 g/mol. Its IUPAC name is 3,5-dichloro-2-(2,2-difluoroethoxy)aniline.
Molecular Properties
| Compound Name | 3,5-dichloro-2-(2,2-difluoroethoxy)aniline |
| PubChem CID | 19622891 |
| Molecular Formula | C8H7Cl2F2NO |
| Molecular Weight | 242.05 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | 3,5-dichloro-2-(2,2-difluoroethoxy)aniline |
| SMILES | Nc1cc(Cl)cc(Cl)c1OCC(F)F |
| InChI | InChI=1S/C8H7Cl2F2NO/c9-4-1-5(10)8(6(13)2-4)14-3-7(11)12/h1-2,7H,3,13H2 |
| InChIKey | RKRGQHSUCDFUDE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.05 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-2-(2,2-difluoroethoxy)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-2-(2,2-difluoroethoxy)aniline?
The IUPAC name of 3,5-dichloro-2-(2,2-difluoroethoxy)aniline (CID 19622891) is 3,5-dichloro-2-(2,2-difluoroethoxy)aniline.
What is the SMILES notation for 3,5-dichloro-2-(2,2-difluoroethoxy)aniline?
The canonical SMILES for 3,5-dichloro-2-(2,2-difluoroethoxy)aniline is Nc1cc(Cl)cc(Cl)c1OCC(F)F.
What is the InChIKey of 3,5-dichloro-2-(2,2-difluoroethoxy)aniline?
The InChIKey is RKRGQHSUCDFUDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl2F2NO/c9-4-1-5(10)8(6(13)2-4)14-3-7(11)12/h1-2,7H,3,13H2.
What are the key properties of 3,5-dichloro-2-(2,2-difluoroethoxy)aniline?
3,5-dichloro-2-(2,2-difluoroethoxy)aniline has a molecular weight of 242.05 g/mol, XLogP of 3.22, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-2-(2,2-difluoroethoxy)aniline is sourced from PubChem (CID 19622891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).