About 2-[4-(difluoromethyl)-1,3-dimethyl-6-oxopyrazolo[5,4-b]pyridin-7-yl]acetic acid
2-[4-(difluoromethyl)-1,3-dimethyl-6-oxopyrazolo[5,4-b]pyridin-7-yl]acetic acid (PubChem CID 19622968) has the molecular formula C11H11F2N3O3
and a molecular weight of 271.22 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)-1,3-dimethyl-6-oxopyrazolo[5,4-b]pyridin-7-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-(difluoromethyl)-1,3-dimethyl-6-oxopyrazolo[5,4-b]pyridin-7-yl]acetic acid |
| PubChem CID | 19622968 |
| Molecular Formula | C11H11F2N3O3 |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-[4-(difluoromethyl)-1,3-dimethyl-6-oxopyrazolo[5,4-b]pyridin-7-yl]acetic acid |
| SMILES | Cc1nn(C)c2c1c(C(F)F)cc(=O)n2CC(=O)O |
| InChI | InChI=1S/C11H11F2N3O3/c1-5-9-6(10(12)13)3-7(17)16(4-8(18)19)11(9)15(2)14-5/h3,10H,4H2,1-2H3,(H,18,19) |
| InChIKey | QAKKHFBQGOWBIE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(difluoromethyl)-1,3-dimethyl-6-oxopyrazolo[5,4-b]pyridin-7-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(difluoromethyl)-1,3-dimethyl-6-oxopyrazolo[5,4-b]pyridin-7-yl]acetic acid?
The IUPAC name of 2-[4-(difluoromethyl)-1,3-dimethyl-6-oxopyrazolo[5,4-b]pyridin-7-yl]acetic acid (CID 19622968) is 2-[4-(difluoromethyl)-1,3-dimethyl-6-oxopyrazolo[5,4-b]pyridin-7-yl]acetic acid.
What is the SMILES notation for 2-[4-(difluoromethyl)-1,3-dimethyl-6-oxopyrazolo[5,4-b]pyridin-7-yl]acetic acid?
The canonical SMILES for 2-[4-(difluoromethyl)-1,3-dimethyl-6-oxopyrazolo[5,4-b]pyridin-7-yl]acetic acid is Cc1nn(C)c2c1c(C(F)F)cc(=O)n2CC(=O)O.
What is the InChIKey of 2-[4-(difluoromethyl)-1,3-dimethyl-6-oxopyrazolo[5,4-b]pyridin-7-yl]acetic acid?
The InChIKey is QAKKHFBQGOWBIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2N3O3/c1-5-9-6(10(12)13)3-7(17)16(4-8(18)19)11(9)15(2)14-5/h3,10H,4H2,1-2H3,(H,18,19).
What are the key properties of 2-[4-(difluoromethyl)-1,3-dimethyl-6-oxopyrazolo[5,4-b]pyridin-7-yl]acetic acid?
2-[4-(difluoromethyl)-1,3-dimethyl-6-oxopyrazolo[5,4-b]pyridin-7-yl]acetic acid has a molecular weight of 271.22 g/mol, XLogP of 1.07, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(difluoromethyl)-1,3-dimethyl-6-oxopyrazolo[5,4-b]pyridin-7-yl]acetic acid is sourced from PubChem (CID 19622968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).