About 2-(3,4-dimethyl-6-oxo-1-propylpyrazolo[5,4-b]pyridin-7-yl)acetic acid
2-(3,4-dimethyl-6-oxo-1-propylpyrazolo[5,4-b]pyridin-7-yl)acetic acid (PubChem CID 19622976) has the molecular formula C13H17N3O3
and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-(3,4-dimethyl-6-oxo-1-propylpyrazolo[5,4-b]pyridin-7-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(3,4-dimethyl-6-oxo-1-propylpyrazolo[5,4-b]pyridin-7-yl)acetic acid |
| PubChem CID | 19622976 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-(3,4-dimethyl-6-oxo-1-propylpyrazolo[5,4-b]pyridin-7-yl)acetic acid |
| SMILES | CCCn1nc(C)c2c(C)cc(=O)n(CC(=O)O)c21 |
| InChI | InChI=1S/C13H17N3O3/c1-4-5-16-13-12(9(3)14-16)8(2)6-10(17)15(13)7-11(18)19/h6H,4-5,7H2,1-3H3,(H,18,19) |
| InChIKey | MQFJQDUAXGGTBC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3,4-dimethyl-6-oxo-1-propylpyrazolo[5,4-b]pyridin-7-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethyl-6-oxo-1-propylpyrazolo[5,4-b]pyridin-7-yl)acetic acid?
The IUPAC name of 2-(3,4-dimethyl-6-oxo-1-propylpyrazolo[5,4-b]pyridin-7-yl)acetic acid (CID 19622976) is 2-(3,4-dimethyl-6-oxo-1-propylpyrazolo[5,4-b]pyridin-7-yl)acetic acid.
What is the SMILES notation for 2-(3,4-dimethyl-6-oxo-1-propylpyrazolo[5,4-b]pyridin-7-yl)acetic acid?
The canonical SMILES for 2-(3,4-dimethyl-6-oxo-1-propylpyrazolo[5,4-b]pyridin-7-yl)acetic acid is CCCn1nc(C)c2c(C)cc(=O)n(CC(=O)O)c21.
What is the InChIKey of 2-(3,4-dimethyl-6-oxo-1-propylpyrazolo[5,4-b]pyridin-7-yl)acetic acid?
The InChIKey is MQFJQDUAXGGTBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O3/c1-4-5-16-13-12(9(3)14-16)8(2)6-10(17)15(13)7-11(18)19/h6H,4-5,7H2,1-3H3,(H,18,19).
What are the key properties of 2-(3,4-dimethyl-6-oxo-1-propylpyrazolo[5,4-b]pyridin-7-yl)acetic acid?
2-(3,4-dimethyl-6-oxo-1-propylpyrazolo[5,4-b]pyridin-7-yl)acetic acid has a molecular weight of 263.30 g/mol, XLogP of 1.31, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethyl-6-oxo-1-propylpyrazolo[5,4-b]pyridin-7-yl)acetic acid is sourced from PubChem (CID 19622976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).