About N-[(2,6-dimethoxyphenyl)methyl]-1-(1-ethylpyrazol-3-yl)methanamine
N-[(2,6-dimethoxyphenyl)methyl]-1-(1-ethylpyrazol-3-yl)methanamine (PubChem CID 19623033) has the molecular formula C15H21N3O2
and a molecular weight of 275.35 g/mol. Its IUPAC name is N-[(2,6-dimethoxyphenyl)methyl]-1-(1-ethylpyrazol-3-yl)methanamine.
Molecular Properties
| Compound Name | N-[(2,6-dimethoxyphenyl)methyl]-1-(1-ethylpyrazol-3-yl)methanamine |
| PubChem CID | 19623033 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-[(2,6-dimethoxyphenyl)methyl]-1-(1-ethylpyrazol-3-yl)methanamine |
| SMILES | CCn1ccc(CNCc2c(OC)cccc2OC)n1 |
| InChI | InChI=1S/C15H21N3O2/c1-4-18-9-8-12(17-18)10-16-11-13-14(19-2)6-5-7-15(13)20-3/h5-9,16H,4,10-11H2,1-3H3 |
| InChIKey | VTJKPEFIGOLKJA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(2,6-dimethoxyphenyl)methyl]-1-(1-ethylpyrazol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,6-dimethoxyphenyl)methyl]-1-(1-ethylpyrazol-3-yl)methanamine?
The IUPAC name of N-[(2,6-dimethoxyphenyl)methyl]-1-(1-ethylpyrazol-3-yl)methanamine (CID 19623033) is N-[(2,6-dimethoxyphenyl)methyl]-1-(1-ethylpyrazol-3-yl)methanamine.
What is the SMILES notation for N-[(2,6-dimethoxyphenyl)methyl]-1-(1-ethylpyrazol-3-yl)methanamine?
The canonical SMILES for N-[(2,6-dimethoxyphenyl)methyl]-1-(1-ethylpyrazol-3-yl)methanamine is CCn1ccc(CNCc2c(OC)cccc2OC)n1.
What is the InChIKey of N-[(2,6-dimethoxyphenyl)methyl]-1-(1-ethylpyrazol-3-yl)methanamine?
The InChIKey is VTJKPEFIGOLKJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O2/c1-4-18-9-8-12(17-18)10-16-11-13-14(19-2)6-5-7-15(13)20-3/h5-9,16H,4,10-11H2,1-3H3.
What are the key properties of N-[(2,6-dimethoxyphenyl)methyl]-1-(1-ethylpyrazol-3-yl)methanamine?
N-[(2,6-dimethoxyphenyl)methyl]-1-(1-ethylpyrazol-3-yl)methanamine has a molecular weight of 275.35 g/mol, XLogP of 2.21, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,6-dimethoxyphenyl)methyl]-1-(1-ethylpyrazol-3-yl)methanamine is sourced from PubChem (CID 19623033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).