C13H17N5O3 — CID 19624221
1-[2-[(2-ethylpyrazol-3-yl)methyl-methylamino]-2-oxoethyl]pyrazole-3-carboxylic acid (PubChem CID 19624221) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 1-[2-[(2-ethylpyrazol-3-yl)methyl-methylamino]-2-oxoethyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[2-[(2-ethylpyrazol-3-yl)methyl-methylamino]-2-oxoethyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19624221 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 1-[2-[(2-ethylpyrazol-3-yl)methyl-methylamino]-2-oxoethyl]pyrazole-3-carboxylic acid |
| SMILES | CCn1nccc1CN(C)C(=O)Cn1ccc(C(=O)O)n1 |
| InChI | InChI=1S/C13H17N5O3/c1-3-18-10(4-6-14-18)8-16(2)12(19)9-17-7-5-11(15-17)13(20)21/h4-7H,3,8-9H2,1-2H3,(H,20,21) |
| InChIKey | YLUVLTHKTWCSFB-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |