C16H21N3O3 — CID 19624801
1-methyl-4-[[3-(2-methylpropoxy)phenyl]methylamino]pyrazole-3-carboxylic acid (PubChem CID 19624801) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-methyl-4-[[3-(2-methylpropoxy)phenyl]methylamino]pyrazole-3-carboxylic acid.
| Compound Name | 1-methyl-4-[[3-(2-methylpropoxy)phenyl]methylamino]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19624801 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-methyl-4-[[3-(2-methylpropoxy)phenyl]methylamino]pyrazole-3-carboxylic acid |
| SMILES | CC(C)COc1cccc(CNc2cn(C)nc2C(=O)O)c1 |
| InChI | InChI=1S/C16H21N3O3/c1-11(2)10-22-13-6-4-5-12(7-13)8-17-14-9-19(3)18-15(14)16(20)21/h4-7,9,11,17H,8,10H2,1-3H3,(H,20,21) |
| InChIKey | NPVKTQUXMJPXTE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |