C13H18F3N5 — CID 19625534
N-[[1-ethyl-5-(trifluoromethyl)pyrazol-3-yl]methyl]-1-(1-methylpyrazol-3-yl)ethanamine (PubChem CID 19625534) has the molecular formula C13H18F3N5 and a molecular weight of 301.32 g/mol. Its IUPAC name is N-[[1-ethyl-5-(trifluoromethyl)pyrazol-3-yl]methyl]-1-(1-methylpyrazol-3-yl)ethanamine.
| Compound Name | N-[[1-ethyl-5-(trifluoromethyl)pyrazol-3-yl]methyl]-1-(1-methylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 19625534 |
| Molecular Formula | C13H18F3N5 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-[[1-ethyl-5-(trifluoromethyl)pyrazol-3-yl]methyl]-1-(1-methylpyrazol-3-yl)ethanamine |
| SMILES | CCn1nc(CNC(C)c2ccn(C)n2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H18F3N5/c1-4-21-12(13(14,15)16)7-10(18-21)8-17-9(2)11-5-6-20(3)19-11/h5-7,9,17H,4,8H2,1-3H3 |
| InChIKey | KXZQGMSGQDCTJV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |