C19H28N4O2 — CID 19625954
1-ethyl-N-[[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methyl]-3-methylpyrazol-4-amine (PubChem CID 19625954) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-ethyl-N-[[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methyl]-3-methylpyrazol-4-amine.
| Compound Name | 1-ethyl-N-[[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methyl]-3-methylpyrazol-4-amine |
|---|---|
| PubChem CID | 19625954 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-ethyl-N-[[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methyl]-3-methylpyrazol-4-amine |
| SMILES | CCn1cc(NCc2ccc(OC)c(CN3CCOCC3)c2)c(C)n1 |
| InChI | InChI=1S/C19H28N4O2/c1-4-23-14-18(15(2)21-23)20-12-16-5-6-19(24-3)17(11-16)13-22-7-9-25-10-8-22/h5-6,11,14,20H,4,7-10,12-13H2,1-3H3 |
| InChIKey | YJHQSXPJDYJMBO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |