C15H17F2N3 — CID 19626149
N-[(2-cyclopentylpyrazol-3-yl)methyl]-2,4-difluoroaniline (PubChem CID 19626149) has the molecular formula C15H17F2N3 and a molecular weight of 277.32 g/mol. Its IUPAC name is N-[(2-cyclopentylpyrazol-3-yl)methyl]-2,4-difluoroaniline.
| Compound Name | N-[(2-cyclopentylpyrazol-3-yl)methyl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 19626149 |
| Molecular Formula | C15H17F2N3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | N-[(2-cyclopentylpyrazol-3-yl)methyl]-2,4-difluoroaniline |
| SMILES | Fc1ccc(NCc2ccnn2C2CCCC2)c(F)c1 |
| InChI | InChI=1S/C15H17F2N3/c16-11-5-6-15(14(17)9-11)18-10-13-7-8-19-20(13)12-3-1-2-4-12/h5-9,12,18H,1-4,10H2 |
| InChIKey | ZAXKVSPHPKBXAR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |