C10H13N3S — CID 19626587
N-[(2-methylpyrazol-3-yl)methyl]-1-thiophen-3-ylmethanamine (PubChem CID 19626587) has the molecular formula C10H13N3S and a molecular weight of 207.30 g/mol. Its IUPAC name is N-[(2-methylpyrazol-3-yl)methyl]-1-thiophen-3-ylmethanamine.
| Compound Name | N-[(2-methylpyrazol-3-yl)methyl]-1-thiophen-3-ylmethanamine |
|---|---|
| PubChem CID | 19626587 |
| Molecular Formula | C10H13N3S |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | N-[(2-methylpyrazol-3-yl)methyl]-1-thiophen-3-ylmethanamine |
| SMILES | Cn1nccc1CNCc1ccsc1 |
| InChI | InChI=1S/C10H13N3S/c1-13-10(2-4-12-13)7-11-6-9-3-5-14-8-9/h2-5,8,11H,6-7H2,1H3 |
| InChIKey | GZGAHDGRDQLVRJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |